C15H18F2N2O2S — CID 84583941
1-[3-(2,5-difluorophenyl)sulfanylpropanoyl]piperidine-2-carboxamide (PubChem CID 84583941) has the molecular formula C15H18F2N2O2S and a molecular weight of 328.38 g/mol. Its IUPAC name is 1-[3-(2,5-difluorophenyl)sulfanylpropanoyl]piperidine-2-carboxamide.
| Compound Name | 1-[3-(2,5-difluorophenyl)sulfanylpropanoyl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 84583941 |
| Molecular Formula | C15H18F2N2O2S |
| Molecular Weight | 328.38 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | 1-[3-(2,5-difluorophenyl)sulfanylpropanoyl]piperidine-2-carboxamide |
| SMILES | NC(=O)C1CCCCN1C(=O)CCSc1cc(F)ccc1F |
| InChI | InChI=1S/C15H18F2N2O2S/c16-10-4-5-11(17)13(9-10)22-8-6-14(20)19-7-2-1-3-12(19)15(18)21/h4-5,9,12H,1-3,6-8H2,(H2,18,21) |
| InChIKey | RNPSFGSIYSMGFT-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.38 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |