C13H14F2O — CID 64502889
1-cyclopropyl-4-(2,5-difluorophenyl)butan-1-one (PubChem CID 64502889) has the molecular formula C13H14F2O and a molecular weight of 224.25 g/mol. Its IUPAC name is 1-cyclopropyl-4-(2,5-difluorophenyl)butan-1-one.
| Compound Name | 1-cyclopropyl-4-(2,5-difluorophenyl)butan-1-one |
|---|---|
| PubChem CID | 64502889 |
| Molecular Formula | C13H14F2O |
| Molecular Weight | 224.25 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | 1-cyclopropyl-4-(2,5-difluorophenyl)butan-1-one |
| SMILES | O=C(CCCc1cc(F)ccc1F)C1CC1 |
| InChI | InChI=1S/C13H14F2O/c14-11-6-7-12(15)10(8-11)2-1-3-13(16)9-4-5-9/h6-9H,1-5H2 |
| InChIKey | AMOUEKFEOCGKII-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.25 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |