C24H28ClF2NO — CID 142018842
(4-chlorophenyl)-[1-[6-(2,5-difluorophenyl)hexyl]piperidin-4-yl]methanone (PubChem CID 142018842) has the molecular formula C24H28ClF2NO and a molecular weight of 419.94 g/mol. Its IUPAC name is (4-chlorophenyl)-[1-[6-(2,5-difluorophenyl)hexyl]piperidin-4-yl]methanone.
| Compound Name | (4-chlorophenyl)-[1-[6-(2,5-difluorophenyl)hexyl]piperidin-4-yl]methanone |
|---|---|
| PubChem CID | 142018842 |
| Molecular Formula | C24H28ClF2NO |
| Molecular Weight | 419.94 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | (4-chlorophenyl)-[1-[6-(2,5-difluorophenyl)hexyl]piperidin-4-yl]methanone |
| SMILES | O=C(c1ccc(Cl)cc1)C1CCN(CCCCCCc2cc(F)ccc2F)CC1 |
| InChI | InChI=1S/C24H28ClF2NO/c25-21-8-6-18(7-9-21)24(29)19-12-15-28(16-13-19)14-4-2-1-3-5-20-17-22(26)10-11-23(20)27/h6-11,17,19H,1-5,12-16H2 |
| InChIKey | FRYVIXBYOSVUOO-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.94 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|