C27H33ClFN3O2 — CID 25015921
1-(4-chlorophenyl)-3-[4-[2-[4-(4-fluorobenzoyl)piperidin-1-yl]ethyl]cyclohexyl]urea (PubChem CID 25015921) has the molecular formula C27H33ClFN3O2 and a molecular weight of 486.03 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[4-[2-[4-(4-fluorobenzoyl)piperidin-1-yl]ethyl]cyclohexyl]urea.
| Compound Name | 1-(4-chlorophenyl)-3-[4-[2-[4-(4-fluorobenzoyl)piperidin-1-yl]ethyl]cyclohexyl]urea |
|---|---|
| PubChem CID | 25015921 |
| Molecular Formula | C27H33ClFN3O2 |
| Molecular Weight | 486.03 g/mol |
| Exact Mass | 485.22 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[4-[2-[4-(4-fluorobenzoyl)piperidin-1-yl]ethyl]cyclohexyl]urea |
| SMILES | O=C(Nc1ccc(Cl)cc1)NC1CCC(CCN2CCC(C(=O)c3ccc(F)cc3)CC2)CC1 |
| InChI | InChI=1S/C27H33ClFN3O2/c28-22-5-11-25(12-6-22)31-27(34)30-24-9-1-19(2-10-24)13-16-32-17-14-21(15-18-32)26(33)20-3-7-23(29)8-4-20/h3-8,11-12,19,21,24H,1-2,9-10,13-18H2,(H2,30,31,34) |
| InChIKey | FLXIPDNIWIWXJJ-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.03 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |