C27H35F2N3O — CID 57162230
(4-fluorophenyl)-[1-[4-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]butyl]piperidin-4-yl]methanone (PubChem CID 57162230) has the molecular formula C27H35F2N3O and a molecular weight of 455.59 g/mol. Its IUPAC name is (4-fluorophenyl)-[1-[4-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]butyl]piperidin-4-yl]methanone.
| Compound Name | (4-fluorophenyl)-[1-[4-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]butyl]piperidin-4-yl]methanone |
|---|---|
| PubChem CID | 57162230 |
| Molecular Formula | C27H35F2N3O |
| Molecular Weight | 455.59 g/mol |
| Exact Mass | 455.27 |
| IUPAC Name | (4-fluorophenyl)-[1-[4-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]butyl]piperidin-4-yl]methanone |
| SMILES | O=C(c1ccc(F)cc1)C1CCN(CCCCN2CCN(Cc3ccccc3F)CC2)CC1 |
| InChI | InChI=1S/C27H35F2N3O/c28-25-9-7-22(8-10-25)27(33)23-11-15-30(16-12-23)13-3-4-14-31-17-19-32(20-18-31)21-24-5-1-2-6-26(24)29/h1-2,5-10,23H,3-4,11-21H2 |
| InChIKey | LVALHBAJTWHLCH-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.59 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|