C20H21FINO — CID 11016205
(4-fluorophenyl)-[1-[2-(2-iodophenyl)ethyl]piperidin-4-yl]methanone (PubChem CID 11016205) has the molecular formula C20H21FINO and a molecular weight of 437.30 g/mol. Its IUPAC name is (4-fluorophenyl)-[1-[2-(2-iodophenyl)ethyl]piperidin-4-yl]methanone.
| Compound Name | (4-fluorophenyl)-[1-[2-(2-iodophenyl)ethyl]piperidin-4-yl]methanone |
|---|---|
| PubChem CID | 11016205 |
| Molecular Formula | C20H21FINO |
| Molecular Weight | 437.30 g/mol |
| Exact Mass | 437.07 |
| IUPAC Name | (4-fluorophenyl)-[1-[2-(2-iodophenyl)ethyl]piperidin-4-yl]methanone |
| SMILES | O=C(c1ccc(F)cc1)C1CCN(CCc2ccccc2I)CC1 |
| InChI | InChI=1S/C20H21FINO/c21-18-7-5-16(6-8-18)20(24)17-10-13-23(14-11-17)12-9-15-3-1-2-4-19(15)22/h1-8,17H,9-14H2 |
| InChIKey | JREBTSVEMYTHEU-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.30 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|