C14H15FN2O — CID 3020042
2-[4-(4-fluorobenzoyl)piperidin-1-yl]acetonitrile (PubChem CID 3020042) has the molecular formula C14H15FN2O and a molecular weight of 246.28 g/mol. Its IUPAC name is 2-[4-(4-fluorobenzoyl)piperidin-1-yl]acetonitrile.
| Compound Name | 2-[4-(4-fluorobenzoyl)piperidin-1-yl]acetonitrile |
|---|---|
| PubChem CID | 3020042 |
| Molecular Formula | C14H15FN2O |
| Molecular Weight | 246.28 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | 2-[4-(4-fluorobenzoyl)piperidin-1-yl]acetonitrile |
| SMILES | N#CCN1CCC(C(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C14H15FN2O/c15-13-3-1-11(2-4-13)14(18)12-5-8-17(9-6-12)10-7-16/h1-4,12H,5-6,8-10H2 |
| InChIKey | MSMHDJPCXSJKSY-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.28 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|