C21H23FN2O6S — CID 162316648
3-[4-[4-(4-fluorobenzoyl)piperidin-1-yl]but-2-ynyl]-1,3-thiazolidin-4-one;oxalic acid (PubChem CID 162316648) has the molecular formula C21H23FN2O6S and a molecular weight of 450.49 g/mol. Its IUPAC name is 3-[4-[4-(4-fluorobenzoyl)piperidin-1-yl]but-2-ynyl]-1,3-thiazolidin-4-one;oxalic acid.
| Compound Name | 3-[4-[4-(4-fluorobenzoyl)piperidin-1-yl]but-2-ynyl]-1,3-thiazolidin-4-one;oxalic acid |
|---|---|
| PubChem CID | 162316648 |
| Molecular Formula | C21H23FN2O6S |
| Molecular Weight | 450.49 g/mol |
| Exact Mass | 450.13 |
| IUPAC Name | 3-[4-[4-(4-fluorobenzoyl)piperidin-1-yl]but-2-ynyl]-1,3-thiazolidin-4-one;oxalic acid |
| SMILES | O=C(O)C(=O)O.O=C(c1ccc(F)cc1)C1CCN(CC#CCN2CSCC2=O)CC1 |
| InChI | InChI=1S/C19H21FN2O2S.C2H2O4/c20-17-5-3-15(4-6-17)19(24)16-7-11-21(12-8-16)9-1-2-10-22-14-25-13-18(22)23;3-1(4)2(5)6/h3-6,16H,7-14H2;(H,3,4)(H,5,6) |
| InChIKey | JBWLPTDVFWEUBM-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 115.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.49 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|