C25H33FN2O3 — CID 23037304
2-[4-[4-(4-fluorobenzoyl)piperidin-1-yl]butyl]-5-methyl-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione (PubChem CID 23037304) has the molecular formula C25H33FN2O3 and a molecular weight of 428.55 g/mol. Its IUPAC name is 2-[4-[4-(4-fluorobenzoyl)piperidin-1-yl]butyl]-5-methyl-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione.
| Compound Name | 2-[4-[4-(4-fluorobenzoyl)piperidin-1-yl]butyl]-5-methyl-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 23037304 |
| Molecular Formula | C25H33FN2O3 |
| Molecular Weight | 428.55 g/mol |
| Exact Mass | 428.25 |
| IUPAC Name | 2-[4-[4-(4-fluorobenzoyl)piperidin-1-yl]butyl]-5-methyl-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
| SMILES | CC1CCC2C(=O)N(CCCCN3CCC(C(=O)c4ccc(F)cc4)CC3)C(=O)C2C1 |
| InChI | InChI=1S/C25H33FN2O3/c1-17-4-9-21-22(16-17)25(31)28(24(21)30)13-3-2-12-27-14-10-19(11-15-27)23(29)18-5-7-20(26)8-6-18/h5-8,17,19,21-22H,2-4,9-16H2,1H3 |
| InChIKey | WXSQJUBWPFHINR-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.55 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|