C21H29BFNO3 — CID 174952895
CID 174952895 (PubChem CID 174952895) has the molecular formula C21H29BFNO3 and a molecular weight of 373.28 g/mol.
| Compound Name | CID 174952895 |
|---|---|
| PubChem CID | 174952895 |
| Molecular Formula | C21H29BFNO3 |
| Molecular Weight | 373.28 g/mol |
| Exact Mass | 373.22 |
| IUPAC Name | — |
| SMILES | [B]OC(=O)C(CCCC)CCCN1CCC(C(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C21H29BFNO3/c1-2-3-5-18(21(26)27-22)6-4-13-24-14-11-17(12-15-24)20(25)16-7-9-19(23)10-8-16/h7-10,17-18H,2-6,11-15H2,1H3 |
| InChIKey | HBYBVVHNZGIGHZ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.28 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|