C29H41FN2O2 — CID 67697538
[1-[3-[3-(dibutylamino)phenoxy]propyl]piperidin-4-yl]-(4-fluorophenyl)methanone (PubChem CID 67697538) has the molecular formula C29H41FN2O2 and a molecular weight of 468.66 g/mol. Its IUPAC name is [1-[3-[3-(dibutylamino)phenoxy]propyl]piperidin-4-yl]-(4-fluorophenyl)methanone.
| Compound Name | [1-[3-[3-(dibutylamino)phenoxy]propyl]piperidin-4-yl]-(4-fluorophenyl)methanone |
|---|---|
| PubChem CID | 67697538 |
| Molecular Formula | C29H41FN2O2 |
| Molecular Weight | 468.66 g/mol |
| Exact Mass | 468.32 |
| IUPAC Name | [1-[3-[3-(dibutylamino)phenoxy]propyl]piperidin-4-yl]-(4-fluorophenyl)methanone |
| SMILES | CCCCN(CCCC)c1cccc(OCCCN2CCC(C(=O)c3ccc(F)cc3)CC2)c1 |
| InChI | InChI=1S/C29H41FN2O2/c1-3-5-18-32(19-6-4-2)27-9-7-10-28(23-27)34-22-8-17-31-20-15-25(16-21-31)29(33)24-11-13-26(30)14-12-24/h7,9-14,23,25H,3-6,8,15-22H2,1-2H3 |
| InChIKey | GPMXFHDQPXEKBF-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.66 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|