C33H40FN3O3 — CID 67670711
N-[2-[4-(4-fluorobenzoyl)piperidin-1-yl]ethyl]-N-(3-methoxyphenyl)-4-(pentylamino)benzamide (PubChem CID 67670711) has the molecular formula C33H40FN3O3 and a molecular weight of 545.70 g/mol. Its IUPAC name is N-[2-[4-(4-fluorobenzoyl)piperidin-1-yl]ethyl]-N-(3-methoxyphenyl)-4-(pentylamino)benzamide.
| Compound Name | N-[2-[4-(4-fluorobenzoyl)piperidin-1-yl]ethyl]-N-(3-methoxyphenyl)-4-(pentylamino)benzamide |
|---|---|
| PubChem CID | 67670711 |
| Molecular Formula | C33H40FN3O3 |
| Molecular Weight | 545.70 g/mol |
| Exact Mass | 545.31 |
| IUPAC Name | N-[2-[4-(4-fluorobenzoyl)piperidin-1-yl]ethyl]-N-(3-methoxyphenyl)-4-(pentylamino)benzamide |
| SMILES | CCCCCNc1ccc(C(=O)N(CCN2CCC(C(=O)c3ccc(F)cc3)CC2)c2cccc(OC)c2)cc1 |
| InChI | InChI=1S/C33H40FN3O3/c1-3-4-5-19-35-29-15-11-27(12-16-29)33(39)37(30-7-6-8-31(24-30)40-2)23-22-36-20-17-26(18-21-36)32(38)25-9-13-28(34)14-10-25/h6-16,24,26,35H,3-5,17-23H2,1-2H3 |
| InChIKey | CTSHSLMSHGSPMY-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.70 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|