C35H38FN3O7 — CID 67670667
4-acetamido-N-(3,4-dimethylphenyl)-N-[2-[4-(4-fluorobenzoyl)piperidin-1-yl]ethyl]benzamide;but-2-enedioic acid (PubChem CID 67670667) has the molecular formula C35H38FN3O7 and a molecular weight of 631.70 g/mol. Its IUPAC name is 4-acetamido-N-(3,4-dimethylphenyl)-N-[2-[4-(4-fluorobenzoyl)piperidin-1-yl]ethyl]benzamide;but-2-enedioic acid.
| Compound Name | 4-acetamido-N-(3,4-dimethylphenyl)-N-[2-[4-(4-fluorobenzoyl)piperidin-1-yl]ethyl]benzamide;but-2-enedioic acid |
|---|---|
| PubChem CID | 67670667 |
| Molecular Formula | C35H38FN3O7 |
| Molecular Weight | 631.70 g/mol |
| Exact Mass | 631.27 |
| IUPAC Name | 4-acetamido-N-(3,4-dimethylphenyl)-N-[2-[4-(4-fluorobenzoyl)piperidin-1-yl]ethyl]benzamide;but-2-enedioic acid |
| SMILES | CC(=O)Nc1ccc(C(=O)N(CCN2CCC(C(=O)c3ccc(F)cc3)CC2)c2ccc(C)c(C)c2)cc1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C31H34FN3O3.C4H4O4/c1-21-4-13-29(20-22(21)2)35(31(38)26-7-11-28(12-8-26)33-23(3)36)19-18-34-16-14-25(15-17-34)30(37)24-5-9-27(32)10-6-24;5-3(6)1-2-4(7)8/h4-13,20,25H,14-19H2,1-3H3,(H,33,36);1-2H,(H,5,6)(H,7,8) |
| InChIKey | OGWITUPZCFXFJC-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 144.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.70 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|