C37H35FN4O7 — CID 19689998
4-benzamido-N-[2-[4-(4-fluorobenzoyl)piperidin-1-yl]ethyl]-N-pyridin-3-ylbenzamide;(E)-but-2-enedioic acid (PubChem CID 19689998) has the molecular formula C37H35FN4O7 and a molecular weight of 666.71 g/mol. Its IUPAC name is 4-benzamido-N-[2-[4-(4-fluorobenzoyl)piperidin-1-yl]ethyl]-N-pyridin-3-ylbenzamide;(E)-but-2-enedioic acid.
| Compound Name | 4-benzamido-N-[2-[4-(4-fluorobenzoyl)piperidin-1-yl]ethyl]-N-pyridin-3-ylbenzamide;(E)-but-2-enedioic acid |
|---|---|
| PubChem CID | 19689998 |
| Molecular Formula | C37H35FN4O7 |
| Molecular Weight | 666.71 g/mol |
| Exact Mass | 666.25 |
| IUPAC Name | 4-benzamido-N-[2-[4-(4-fluorobenzoyl)piperidin-1-yl]ethyl]-N-pyridin-3-ylbenzamide;(E)-but-2-enedioic acid |
| SMILES | O=C(Nc1ccc(C(=O)N(CCN2CCC(C(=O)c3ccc(F)cc3)CC2)c2cccnc2)cc1)c1ccccc1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C33H31FN4O3.C4H4O4/c34-28-12-8-24(9-13-28)31(39)25-16-19-37(20-17-25)21-22-38(30-7-4-18-35-23-30)33(41)27-10-14-29(15-11-27)36-32(40)26-5-2-1-3-6-26;5-3(6)1-2-4(7)8/h1-15,18,23,25H,16-17,19-22H2,(H,36,40);1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | MJEZQQZOYWZKCK-WLHGVMLRSA-N |
| XLogP | 5.43 |
| TPSA | 157.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.71 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|