C33H31FN4O3 — CID 139760427
N-[2-(4-benzoylpiperidin-1-yl)ethyl]-4-[(4-fluorobenzoyl)amino]-N-pyridin-3-ylbenzamide (PubChem CID 139760427) has the molecular formula C33H31FN4O3 and a molecular weight of 550.63 g/mol. Its IUPAC name is N-[2-(4-benzoylpiperidin-1-yl)ethyl]-4-[(4-fluorobenzoyl)amino]-N-pyridin-3-ylbenzamide.
| Compound Name | N-[2-(4-benzoylpiperidin-1-yl)ethyl]-4-[(4-fluorobenzoyl)amino]-N-pyridin-3-ylbenzamide |
|---|---|
| PubChem CID | 139760427 |
| Molecular Formula | C33H31FN4O3 |
| Molecular Weight | 550.63 g/mol |
| Exact Mass | 550.24 |
| IUPAC Name | N-[2-(4-benzoylpiperidin-1-yl)ethyl]-4-[(4-fluorobenzoyl)amino]-N-pyridin-3-ylbenzamide |
| SMILES | O=C(Nc1ccc(C(=O)N(CCN2CCC(C(=O)c3ccccc3)CC2)c2cccnc2)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C33H31FN4O3/c34-28-12-8-26(9-13-28)32(40)36-29-14-10-27(11-15-29)33(41)38(30-7-4-18-35-23-30)22-21-37-19-16-25(17-20-37)31(39)24-5-2-1-3-6-24/h1-15,18,23,25H,16-17,19-22H2,(H,36,40) |
| InChIKey | QBLIBUVDLXKGGZ-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.63 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |