C30H32FN3O3 — CID 19689916
4-acetamido-N-[2-[4-(4-fluorobenzoyl)piperidin-1-yl]ethyl]-N-(3-methylphenyl)benzamide (PubChem CID 19689916) has the molecular formula C30H32FN3O3 and a molecular weight of 501.60 g/mol. Its IUPAC name is 4-acetamido-N-[2-[4-(4-fluorobenzoyl)piperidin-1-yl]ethyl]-N-(3-methylphenyl)benzamide.
| Compound Name | 4-acetamido-N-[2-[4-(4-fluorobenzoyl)piperidin-1-yl]ethyl]-N-(3-methylphenyl)benzamide |
|---|---|
| PubChem CID | 19689916 |
| Molecular Formula | C30H32FN3O3 |
| Molecular Weight | 501.60 g/mol |
| Exact Mass | 501.24 |
| IUPAC Name | 4-acetamido-N-[2-[4-(4-fluorobenzoyl)piperidin-1-yl]ethyl]-N-(3-methylphenyl)benzamide |
| SMILES | CC(=O)Nc1ccc(C(=O)N(CCN2CCC(C(=O)c3ccc(F)cc3)CC2)c2cccc(C)c2)cc1 |
| InChI | InChI=1S/C30H32FN3O3/c1-21-4-3-5-28(20-21)34(30(37)25-8-12-27(13-9-25)32-22(2)35)19-18-33-16-14-24(15-17-33)29(36)23-6-10-26(31)11-7-23/h3-13,20,24H,14-19H2,1-2H3,(H,32,35) |
| InChIKey | RCOXUVNKLQIZSO-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.60 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |