C34H36FN3O7S — CID 19689853
4-acetamido-N-[2-[4-(4-fluorobenzoyl)piperidin-1-yl]ethyl]-N-(3-methylsulfanylphenyl)benzamide;(E)-but-2-enedioic acid (PubChem CID 19689853) has the molecular formula C34H36FN3O7S and a molecular weight of 649.74 g/mol. Its IUPAC name is 4-acetamido-N-[2-[4-(4-fluorobenzoyl)piperidin-1-yl]ethyl]-N-(3-methylsulfanylphenyl)benzamide;(E)-but-2-enedioic acid.
| Compound Name | 4-acetamido-N-[2-[4-(4-fluorobenzoyl)piperidin-1-yl]ethyl]-N-(3-methylsulfanylphenyl)benzamide;(E)-but-2-enedioic acid |
|---|---|
| PubChem CID | 19689853 |
| Molecular Formula | C34H36FN3O7S |
| Molecular Weight | 649.74 g/mol |
| Exact Mass | 649.23 |
| IUPAC Name | 4-acetamido-N-[2-[4-(4-fluorobenzoyl)piperidin-1-yl]ethyl]-N-(3-methylsulfanylphenyl)benzamide;(E)-but-2-enedioic acid |
| SMILES | CSc1cccc(N(CCN2CCC(C(=O)c3ccc(F)cc3)CC2)C(=O)c2ccc(NC(C)=O)cc2)c1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C30H32FN3O3S.C4H4O4/c1-21(35)32-26-12-8-24(9-13-26)30(37)34(27-4-3-5-28(20-27)38-2)19-18-33-16-14-23(15-17-33)29(36)22-6-10-25(31)11-7-22;5-3(6)1-2-4(7)8/h3-13,20,23H,14-19H2,1-2H3,(H,32,35);1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | GHXPMYVJGADHRY-WLHGVMLRSA-N |
| XLogP | 5.46 |
| TPSA | 144.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.74 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|