C36H40FN3O8 — CID 67672592
4-(butanoylamino)-N-[2-[4-(4-fluorobenzoyl)piperidin-1-yl]ethyl]-N-(2-methoxyphenyl)benzamide;but-2-enedioic acid (PubChem CID 67672592) has the molecular formula C36H40FN3O8 and a molecular weight of 661.73 g/mol. Its IUPAC name is 4-(butanoylamino)-N-[2-[4-(4-fluorobenzoyl)piperidin-1-yl]ethyl]-N-(2-methoxyphenyl)benzamide;but-2-enedioic acid.
| Compound Name | 4-(butanoylamino)-N-[2-[4-(4-fluorobenzoyl)piperidin-1-yl]ethyl]-N-(2-methoxyphenyl)benzamide;but-2-enedioic acid |
|---|---|
| PubChem CID | 67672592 |
| Molecular Formula | C36H40FN3O8 |
| Molecular Weight | 661.73 g/mol |
| Exact Mass | 661.28 |
| IUPAC Name | 4-(butanoylamino)-N-[2-[4-(4-fluorobenzoyl)piperidin-1-yl]ethyl]-N-(2-methoxyphenyl)benzamide;but-2-enedioic acid |
| SMILES | CCCC(=O)Nc1ccc(C(=O)N(CCN2CCC(C(=O)c3ccc(F)cc3)CC2)c2ccccc2OC)cc1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C32H36FN3O4.C4H4O4/c1-3-6-30(37)34-27-15-11-25(12-16-27)32(39)36(28-7-4-5-8-29(28)40-2)22-21-35-19-17-24(18-20-35)31(38)23-9-13-26(33)14-10-23;5-3(6)1-2-4(7)8/h4-5,7-16,24H,3,6,17-22H2,1-2H3,(H,34,37);1-2H,(H,5,6)(H,7,8) |
| InChIKey | RLDKTJMLFARJLY-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 153.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.73 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|