C31H35FN4O3S — CID 22356987
4-[carbamothioyl(ethyl)amino]-N-[2-[4-(4-fluorobenzoyl)piperidin-1-yl]ethyl]-N-(2-methoxyphenyl)benzamide (PubChem CID 22356987) has the molecular formula C31H35FN4O3S and a molecular weight of 562.71 g/mol. Its IUPAC name is 4-[carbamothioyl(ethyl)amino]-N-[2-[4-(4-fluorobenzoyl)piperidin-1-yl]ethyl]-N-(2-methoxyphenyl)benzamide.
| Compound Name | 4-[carbamothioyl(ethyl)amino]-N-[2-[4-(4-fluorobenzoyl)piperidin-1-yl]ethyl]-N-(2-methoxyphenyl)benzamide |
|---|---|
| PubChem CID | 22356987 |
| Molecular Formula | C31H35FN4O3S |
| Molecular Weight | 562.71 g/mol |
| Exact Mass | 562.24 |
| IUPAC Name | 4-[carbamothioyl(ethyl)amino]-N-[2-[4-(4-fluorobenzoyl)piperidin-1-yl]ethyl]-N-(2-methoxyphenyl)benzamide |
| SMILES | CCN(C(N)=S)c1ccc(C(=O)N(CCN2CCC(C(=O)c3ccc(F)cc3)CC2)c2ccccc2OC)cc1 |
| InChI | InChI=1S/C31H35FN4O3S/c1-3-35(31(33)40)26-14-10-24(11-15-26)30(38)36(27-6-4-5-7-28(27)39-2)21-20-34-18-16-23(17-19-34)29(37)22-8-12-25(32)13-9-22/h4-15,23H,3,16-21H2,1-2H3,(H2,33,40) |
| InChIKey | IDCWCBZENRSAAC-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 79.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.71 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|