C33H35FN4O7 — CID 22357074
(E)-but-2-enedioic acid;4-carbamimidoyl-N-[2-[4-(4-fluorobenzoyl)piperidin-1-yl]ethyl]-N-(4-methoxyphenyl)benzamide (PubChem CID 22357074) has the molecular formula C33H35FN4O7 and a molecular weight of 618.66 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;4-carbamimidoyl-N-[2-[4-(4-fluorobenzoyl)piperidin-1-yl]ethyl]-N-(4-methoxyphenyl)benzamide.
| Compound Name | (E)-but-2-enedioic acid;4-carbamimidoyl-N-[2-[4-(4-fluorobenzoyl)piperidin-1-yl]ethyl]-N-(4-methoxyphenyl)benzamide |
|---|---|
| PubChem CID | 22357074 |
| Molecular Formula | C33H35FN4O7 |
| Molecular Weight | 618.66 g/mol |
| Exact Mass | 618.25 |
| IUPAC Name | (E)-but-2-enedioic acid;4-carbamimidoyl-N-[2-[4-(4-fluorobenzoyl)piperidin-1-yl]ethyl]-N-(4-methoxyphenyl)benzamide |
| SMILES | O=C(O)/C=C/C(=O)O.[H]/N=C(\N)c1ccc(C(=O)N(CCN2CCC(C(=O)c3ccc(F)cc3)CC2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C29H31FN4O3.C4H4O4/c1-37-26-12-10-25(11-13-26)34(29(36)23-4-2-22(3-5-23)28(31)32)19-18-33-16-14-21(15-17-33)27(35)20-6-8-24(30)9-7-20;5-3(6)1-2-4(7)8/h2-13,21H,14-19H2,1H3,(H3,31,32);1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | AUQRDZPSSWUXPD-WLHGVMLRSA-N |
| XLogP | 4.07 |
| TPSA | 174.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.66 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|