C33H38FN3O7 — CID 19690033
4-[(dimethylamino)methyl]-N-[2-[4-(4-fluorobenzoyl)piperidin-1-yl]ethyl]-N-(2-methoxyphenyl)benzamide;oxalic acid (PubChem CID 19690033) has the molecular formula C33H38FN3O7 and a molecular weight of 607.68 g/mol. Its IUPAC name is 4-[(dimethylamino)methyl]-N-[2-[4-(4-fluorobenzoyl)piperidin-1-yl]ethyl]-N-(2-methoxyphenyl)benzamide;oxalic acid.
| Compound Name | 4-[(dimethylamino)methyl]-N-[2-[4-(4-fluorobenzoyl)piperidin-1-yl]ethyl]-N-(2-methoxyphenyl)benzamide;oxalic acid |
|---|---|
| PubChem CID | 19690033 |
| Molecular Formula | C33H38FN3O7 |
| Molecular Weight | 607.68 g/mol |
| Exact Mass | 607.27 |
| IUPAC Name | 4-[(dimethylamino)methyl]-N-[2-[4-(4-fluorobenzoyl)piperidin-1-yl]ethyl]-N-(2-methoxyphenyl)benzamide;oxalic acid |
| SMILES | COc1ccccc1N(CCN1CCC(C(=O)c2ccc(F)cc2)CC1)C(=O)c1ccc(CN(C)C)cc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C31H36FN3O3.C2H2O4/c1-33(2)22-23-8-10-26(11-9-23)31(37)35(28-6-4-5-7-29(28)38-3)21-20-34-18-16-25(17-19-34)30(36)24-12-14-27(32)15-13-24;3-1(4)2(5)6/h4-15,25H,16-22H2,1-3H3;(H,3,4)(H,5,6) |
| InChIKey | NDMGRBFTBGURLH-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 127.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.68 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|