C32H36FN3O7 — CID 19689966
N-[2-[4-(4-fluorobenzoyl)piperidin-1-yl]ethyl]-N-(2-methoxyphenyl)-4-(methylaminomethyl)benzamide;oxalic acid (PubChem CID 19689966) has the molecular formula C32H36FN3O7 and a molecular weight of 593.65 g/mol. Its IUPAC name is N-[2-[4-(4-fluorobenzoyl)piperidin-1-yl]ethyl]-N-(2-methoxyphenyl)-4-(methylaminomethyl)benzamide;oxalic acid.
| Compound Name | N-[2-[4-(4-fluorobenzoyl)piperidin-1-yl]ethyl]-N-(2-methoxyphenyl)-4-(methylaminomethyl)benzamide;oxalic acid |
|---|---|
| PubChem CID | 19689966 |
| Molecular Formula | C32H36FN3O7 |
| Molecular Weight | 593.65 g/mol |
| Exact Mass | 593.25 |
| IUPAC Name | N-[2-[4-(4-fluorobenzoyl)piperidin-1-yl]ethyl]-N-(2-methoxyphenyl)-4-(methylaminomethyl)benzamide;oxalic acid |
| SMILES | CNCc1ccc(C(=O)N(CCN2CCC(C(=O)c3ccc(F)cc3)CC2)c2ccccc2OC)cc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C30H34FN3O3.C2H2O4/c1-32-21-22-7-9-25(10-8-22)30(36)34(27-5-3-4-6-28(27)37-2)20-19-33-17-15-24(16-18-33)29(35)23-11-13-26(31)14-12-23;3-1(4)2(5)6/h3-14,24,32H,15-21H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | OFEJRTJTTKLKKO-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 136.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.65 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|