C66H74F2N8O10 — CID 131720571
(E)-but-2-enedioic acid;bis(N-[2-[4-(4-fluorobenzoyl)piperidin-1-yl]ethyl]-4-(pentanoylamino)-N-pyridin-3-ylbenzamide) (PubChem CID 131720571) has the molecular formula C66H74F2N8O10 and a molecular weight of 1177.36 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;bis(N-[2-[4-(4-fluorobenzoyl)piperidin-1-yl]ethyl]-4-(pentanoylamino)-N-pyridin-3-ylbenzamide).
| Compound Name | (E)-but-2-enedioic acid;bis(N-[2-[4-(4-fluorobenzoyl)piperidin-1-yl]ethyl]-4-(pentanoylamino)-N-pyridin-3-ylbenzamide) |
|---|---|
| PubChem CID | 131720571 |
| Molecular Formula | C66H74F2N8O10 |
| Molecular Weight | 1177.36 g/mol |
| Exact Mass | 1176.55 |
| IUPAC Name | (E)-but-2-enedioic acid;bis(N-[2-[4-(4-fluorobenzoyl)piperidin-1-yl]ethyl]-4-(pentanoylamino)-N-pyridin-3-ylbenzamide) |
| SMILES | CCCCC(=O)Nc1ccc(C(=O)N(CCN2CCC(C(=O)c3ccc(F)cc3)CC2)c2cccnc2)cc1.CCCCC(=O)Nc1ccc(C(=O)N(CCN2CCC(C(=O)c3ccc(F)cc3)CC2)c2cccnc2)cc1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/2C31H35FN4O3.C4H4O4/c2*1-2-3-6-29(37)34-27-13-9-25(10-14-27)31(39)36(28-5-4-17-33-22-28)21-20-35-18-15-24(16-19-35)30(38)23-7-11-26(32)12-8-23;5-3(6)1-2-4(7)8/h2*4-5,7-14,17,22,24H,2-3,6,15-16,18-21H2,1H3,(H,34,37);1-2H,(H,5,6)(H,7,8)/b;;2-1+ |
| InChIKey | PVIWOAUNHBQUDI-WXXKFALUSA-N |
| XLogP | 10.89 |
| TPSA | 239.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 86 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1177.36 |
| LogP ≤ 5 | 10.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|