C28H31FN4O2 — CID 19690032
4-(ethylamino)-N-[2-[4-(4-fluorobenzoyl)piperidin-1-yl]ethyl]-N-pyridin-3-ylbenzamide (PubChem CID 19690032) has the molecular formula C28H31FN4O2 and a molecular weight of 474.58 g/mol. Its IUPAC name is 4-(ethylamino)-N-[2-[4-(4-fluorobenzoyl)piperidin-1-yl]ethyl]-N-pyridin-3-ylbenzamide.
| Compound Name | 4-(ethylamino)-N-[2-[4-(4-fluorobenzoyl)piperidin-1-yl]ethyl]-N-pyridin-3-ylbenzamide |
|---|---|
| PubChem CID | 19690032 |
| Molecular Formula | C28H31FN4O2 |
| Molecular Weight | 474.58 g/mol |
| Exact Mass | 474.24 |
| IUPAC Name | 4-(ethylamino)-N-[2-[4-(4-fluorobenzoyl)piperidin-1-yl]ethyl]-N-pyridin-3-ylbenzamide |
| SMILES | CCNc1ccc(C(=O)N(CCN2CCC(C(=O)c3ccc(F)cc3)CC2)c2cccnc2)cc1 |
| InChI | InChI=1S/C28H31FN4O2/c1-2-31-25-11-7-23(8-12-25)28(35)33(26-4-3-15-30-20-26)19-18-32-16-13-22(14-17-32)27(34)21-5-9-24(29)10-6-21/h3-12,15,20,22,31H,2,13-14,16-19H2,1H3 |
| InChIKey | FEPAWHHVOMTMHN-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.58 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |