C23H25FN2O4S — CID 14392435
2-[4-[4-(4-fluorobenzoyl)piperidin-1-yl]butyl]-1,1-dioxo-1,2-benzothiazol-3-one (PubChem CID 14392435) has the molecular formula C23H25FN2O4S and a molecular weight of 444.53 g/mol. Its IUPAC name is 2-[4-[4-(4-fluorobenzoyl)piperidin-1-yl]butyl]-1,1-dioxo-1,2-benzothiazol-3-one.
| Compound Name | 2-[4-[4-(4-fluorobenzoyl)piperidin-1-yl]butyl]-1,1-dioxo-1,2-benzothiazol-3-one |
|---|---|
| PubChem CID | 14392435 |
| Molecular Formula | C23H25FN2O4S |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | 2-[4-[4-(4-fluorobenzoyl)piperidin-1-yl]butyl]-1,1-dioxo-1,2-benzothiazol-3-one |
| SMILES | O=C(c1ccc(F)cc1)C1CCN(CCCCN2C(=O)c3ccccc3S2(=O)=O)CC1 |
| InChI | InChI=1S/C23H25FN2O4S/c24-19-9-7-17(8-10-19)22(27)18-11-15-25(16-12-18)13-3-4-14-26-23(28)20-5-1-2-6-21(20)31(26,29)30/h1-2,5-10,18H,3-4,11-16H2 |
| InChIKey | GFKDLXUWUHFVBF-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|