C22H25N3O5S — CID 14497298
2-[1-[4-(1,1,3-trioxo-1,2-benzothiazol-2-yl)butyl]pyrrolidin-3-yl]oxybenzamide (PubChem CID 14497298) has the molecular formula C22H25N3O5S and a molecular weight of 443.53 g/mol. Its IUPAC name is 2-[1-[4-(1,1,3-trioxo-1,2-benzothiazol-2-yl)butyl]pyrrolidin-3-yl]oxybenzamide.
| Compound Name | 2-[1-[4-(1,1,3-trioxo-1,2-benzothiazol-2-yl)butyl]pyrrolidin-3-yl]oxybenzamide |
|---|---|
| PubChem CID | 14497298 |
| Molecular Formula | C22H25N3O5S |
| Molecular Weight | 443.53 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | 2-[1-[4-(1,1,3-trioxo-1,2-benzothiazol-2-yl)butyl]pyrrolidin-3-yl]oxybenzamide |
| SMILES | NC(=O)c1ccccc1OC1CCN(CCCCN2C(=O)c3ccccc3S2(=O)=O)C1 |
| InChI | InChI=1S/C22H25N3O5S/c23-21(26)17-7-1-3-9-19(17)30-16-11-14-24(15-16)12-5-6-13-25-22(27)18-8-2-4-10-20(18)31(25,28)29/h1-4,7-10,16H,5-6,11-15H2,(H2,23,26) |
| InChIKey | QOZXMBAXVWEYER-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 110.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.53 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|