C27H30N2O4S — CID 14497342
6-[4-[3-(2-methoxyphenoxy)pyrrolidin-1-yl]butyl]benzo[c][1,2]benzothiazine 5,5-dioxide (PubChem CID 14497342) has the molecular formula C27H30N2O4S and a molecular weight of 478.61 g/mol. Its IUPAC name is 6-[4-[3-(2-methoxyphenoxy)pyrrolidin-1-yl]butyl]benzo[c][1,2]benzothiazine 5,5-dioxide.
| Compound Name | 6-[4-[3-(2-methoxyphenoxy)pyrrolidin-1-yl]butyl]benzo[c][1,2]benzothiazine 5,5-dioxide |
|---|---|
| PubChem CID | 14497342 |
| Molecular Formula | C27H30N2O4S |
| Molecular Weight | 478.61 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | 6-[4-[3-(2-methoxyphenoxy)pyrrolidin-1-yl]butyl]benzo[c][1,2]benzothiazine 5,5-dioxide |
| SMILES | COc1ccccc1OC1CCN(CCCCN2c3ccccc3-c3ccccc3S2(=O)=O)C1 |
| InChI | InChI=1S/C27H30N2O4S/c1-32-25-13-5-6-14-26(25)33-21-16-19-28(20-21)17-8-9-18-29-24-12-4-2-10-22(24)23-11-3-7-15-27(23)34(29,30)31/h2-7,10-15,21H,8-9,16-20H2,1H3 |
| InChIKey | AHFYGWGYJKIDJA-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.61 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|