C22H26FN3O3S — CID 134142049
2-[4-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]butyl]-1,1-dioxo-1,2-benzothiazol-3-one (PubChem CID 134142049) has the molecular formula C22H26FN3O3S and a molecular weight of 431.53 g/mol. Its IUPAC name is 2-[4-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]butyl]-1,1-dioxo-1,2-benzothiazol-3-one.
| Compound Name | 2-[4-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]butyl]-1,1-dioxo-1,2-benzothiazol-3-one |
|---|---|
| PubChem CID | 134142049 |
| Molecular Formula | C22H26FN3O3S |
| Molecular Weight | 431.53 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | 2-[4-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]butyl]-1,1-dioxo-1,2-benzothiazol-3-one |
| SMILES | O=C1c2ccccc2S(=O)(=O)N1CCCCN1CCN(Cc2ccccc2F)CC1 |
| InChI | InChI=1S/C22H26FN3O3S/c23-20-9-3-1-7-18(20)17-25-15-13-24(14-16-25)11-5-6-12-26-22(27)19-8-2-4-10-21(19)30(26,28)29/h1-4,7-10H,5-6,11-17H2 |
| InChIKey | YEEFBUYVZCMDBH-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.53 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|