C24H28F3N3O3S — CID 155529450
1,1-dioxo-2-[6-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]hexyl]-1,2-benzothiazol-3-one (PubChem CID 155529450) has the molecular formula C24H28F3N3O3S and a molecular weight of 495.57 g/mol. Its IUPAC name is 1,1-dioxo-2-[6-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]hexyl]-1,2-benzothiazol-3-one.
| Compound Name | 1,1-dioxo-2-[6-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]hexyl]-1,2-benzothiazol-3-one |
|---|---|
| PubChem CID | 155529450 |
| Molecular Formula | C24H28F3N3O3S |
| Molecular Weight | 495.57 g/mol |
| Exact Mass | 495.18 |
| IUPAC Name | 1,1-dioxo-2-[6-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]hexyl]-1,2-benzothiazol-3-one |
| SMILES | O=C1c2ccccc2S(=O)(=O)N1CCCCCCN1CCN(c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C24H28F3N3O3S/c25-24(26,27)19-8-7-9-20(18-19)29-16-14-28(15-17-29)12-5-1-2-6-13-30-23(31)21-10-3-4-11-22(21)34(30,32)33/h3-4,7-11,18H,1-2,5-6,12-17H2 |
| InChIKey | ATEBFGWCGSVURN-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.57 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|