C27H30FNO5 — CID 67779034
3-[4-[4-(4-fluorobenzoyl)piperidin-1-yl]butyl]-6,7-dimethoxychromen-4-one (PubChem CID 67779034) has the molecular formula C27H30FNO5 and a molecular weight of 467.54 g/mol. Its IUPAC name is 3-[4-[4-(4-fluorobenzoyl)piperidin-1-yl]butyl]-6,7-dimethoxychromen-4-one.
| Compound Name | 3-[4-[4-(4-fluorobenzoyl)piperidin-1-yl]butyl]-6,7-dimethoxychromen-4-one |
|---|---|
| PubChem CID | 67779034 |
| Molecular Formula | C27H30FNO5 |
| Molecular Weight | 467.54 g/mol |
| Exact Mass | 467.21 |
| IUPAC Name | 3-[4-[4-(4-fluorobenzoyl)piperidin-1-yl]butyl]-6,7-dimethoxychromen-4-one |
| SMILES | COc1cc2occ(CCCCN3CCC(C(=O)c4ccc(F)cc4)CC3)c(=O)c2cc1OC |
| InChI | InChI=1S/C27H30FNO5/c1-32-24-15-22-23(16-25(24)33-2)34-17-20(27(22)31)5-3-4-12-29-13-10-19(11-14-29)26(30)18-6-8-21(28)9-7-18/h6-9,15-17,19H,3-5,10-14H2,1-2H3 |
| InChIKey | YETRUERWGCLVKQ-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.54 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|