C25H30N2O5 — CID 51000678
3-[4-[4-(3-hydroxyphenyl)piperazin-1-yl]butyl]-6,7-dimethoxychromen-4-one (PubChem CID 51000678) has the molecular formula C25H30N2O5 and a molecular weight of 438.52 g/mol. Its IUPAC name is 3-[4-[4-(3-hydroxyphenyl)piperazin-1-yl]butyl]-6,7-dimethoxychromen-4-one.
| Compound Name | 3-[4-[4-(3-hydroxyphenyl)piperazin-1-yl]butyl]-6,7-dimethoxychromen-4-one |
|---|---|
| PubChem CID | 51000678 |
| Molecular Formula | C25H30N2O5 |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | 3-[4-[4-(3-hydroxyphenyl)piperazin-1-yl]butyl]-6,7-dimethoxychromen-4-one |
| SMILES | COc1cc2occ(CCCCN3CCN(c4cccc(O)c4)CC3)c(=O)c2cc1OC |
| InChI | InChI=1S/C25H30N2O5/c1-30-23-15-21-22(16-24(23)31-2)32-17-18(25(21)29)6-3-4-9-26-10-12-27(13-11-26)19-7-5-8-20(28)14-19/h5,7-8,14-17,28H,3-4,6,9-13H2,1-2H3 |
| InChIKey | PRIMEGXXBMBQFZ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 75.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|