C25H29N3O4 — CID 67989763
6,7-dimethyl-3-[4-[4-(3-nitrophenyl)piperazin-1-yl]butyl]chromen-4-one (PubChem CID 67989763) has the molecular formula C25H29N3O4 and a molecular weight of 435.52 g/mol. Its IUPAC name is 6,7-dimethyl-3-[4-[4-(3-nitrophenyl)piperazin-1-yl]butyl]chromen-4-one.
| Compound Name | 6,7-dimethyl-3-[4-[4-(3-nitrophenyl)piperazin-1-yl]butyl]chromen-4-one |
|---|---|
| PubChem CID | 67989763 |
| Molecular Formula | C25H29N3O4 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | 6,7-dimethyl-3-[4-[4-(3-nitrophenyl)piperazin-1-yl]butyl]chromen-4-one |
| SMILES | Cc1cc2occ(CCCCN3CCN(c4cccc([N+](=O)[O-])c4)CC3)c(=O)c2cc1C |
| InChI | InChI=1S/C25H29N3O4/c1-18-14-23-24(15-19(18)2)32-17-20(25(23)29)6-3-4-9-26-10-12-27(13-11-26)21-7-5-8-22(16-21)28(30)31/h5,7-8,14-17H,3-4,6,9-13H2,1-2H3 |
| InChIKey | CBEAFBBETBFZCJ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 79.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|