C21H29ClN4O4S — CID 67014612
4-methyl-N-[4-[4-(3-nitrophenyl)piperazin-1-yl]butyl]benzenesulfonamide;hydrochloride (PubChem CID 67014612) has the molecular formula C21H29ClN4O4S and a molecular weight of 469.01 g/mol. Its IUPAC name is 4-methyl-N-[4-[4-(3-nitrophenyl)piperazin-1-yl]butyl]benzenesulfonamide;hydrochloride.
| Compound Name | 4-methyl-N-[4-[4-(3-nitrophenyl)piperazin-1-yl]butyl]benzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 67014612 |
| Molecular Formula | C21H29ClN4O4S |
| Molecular Weight | 469.01 g/mol |
| Exact Mass | 468.16 |
| IUPAC Name | 4-methyl-N-[4-[4-(3-nitrophenyl)piperazin-1-yl]butyl]benzenesulfonamide;hydrochloride |
| SMILES | Cc1ccc(S(=O)(=O)NCCCCN2CCN(c3cccc([N+](=O)[O-])c3)CC2)cc1.Cl |
| InChI | InChI=1S/C21H28N4O4S.ClH/c1-18-7-9-21(10-8-18)30(28,29)22-11-2-3-12-23-13-15-24(16-14-23)19-5-4-6-20(17-19)25(26)27;/h4-10,17,22H,2-3,11-16H2,1H3;1H |
| InChIKey | TVKOPMIHRLBNQR-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 95.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.01 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|