C22H30N4O5S — CID 39657662
2-methoxy-N-[4-[4-(3-methylphenyl)piperazin-1-yl]butyl]-4-nitrobenzenesulfonamide (PubChem CID 39657662) has the molecular formula C22H30N4O5S and a molecular weight of 462.57 g/mol. Its IUPAC name is 2-methoxy-N-[4-[4-(3-methylphenyl)piperazin-1-yl]butyl]-4-nitrobenzenesulfonamide.
| Compound Name | 2-methoxy-N-[4-[4-(3-methylphenyl)piperazin-1-yl]butyl]-4-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 39657662 |
| Molecular Formula | C22H30N4O5S |
| Molecular Weight | 462.57 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | 2-methoxy-N-[4-[4-(3-methylphenyl)piperazin-1-yl]butyl]-4-nitrobenzenesulfonamide |
| SMILES | COc1cc([N+](=O)[O-])ccc1S(=O)(=O)NCCCCN1CCN(c2cccc(C)c2)CC1 |
| InChI | InChI=1S/C22H30N4O5S/c1-18-6-5-7-19(16-18)25-14-12-24(13-15-25)11-4-3-10-23-32(29,30)22-9-8-20(26(27)28)17-21(22)31-2/h5-9,16-17,23H,3-4,10-15H2,1-2H3 |
| InChIKey | ODSWLUNNTDFSRX-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 105.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.57 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|