C19H26N4O2S — CID 55819973
N-[3-[4-(3-methylphenyl)piperazin-1-yl]propyl]pyridine-3-sulfonamide (PubChem CID 55819973) has the molecular formula C19H26N4O2S and a molecular weight of 374.51 g/mol. Its IUPAC name is N-[3-[4-(3-methylphenyl)piperazin-1-yl]propyl]pyridine-3-sulfonamide.
| Compound Name | N-[3-[4-(3-methylphenyl)piperazin-1-yl]propyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 55819973 |
| Molecular Formula | C19H26N4O2S |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | N-[3-[4-(3-methylphenyl)piperazin-1-yl]propyl]pyridine-3-sulfonamide |
| SMILES | Cc1cccc(N2CCN(CCCNS(=O)(=O)c3cccnc3)CC2)c1 |
| InChI | InChI=1S/C19H26N4O2S/c1-17-5-2-6-18(15-17)23-13-11-22(12-14-23)10-4-9-21-26(24,25)19-7-3-8-20-16-19/h2-3,5-8,15-16,21H,4,9-14H2,1H3 |
| InChIKey | WTBMEQWWFXTBAP-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|