C25H27F3N2O3 — CID 51001825
6-methoxy-3-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butyl]chromen-4-one (PubChem CID 51001825) has the molecular formula C25H27F3N2O3 and a molecular weight of 460.50 g/mol. Its IUPAC name is 6-methoxy-3-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butyl]chromen-4-one.
| Compound Name | 6-methoxy-3-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butyl]chromen-4-one |
|---|---|
| PubChem CID | 51001825 |
| Molecular Formula | C25H27F3N2O3 |
| Molecular Weight | 460.50 g/mol |
| Exact Mass | 460.20 |
| IUPAC Name | 6-methoxy-3-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butyl]chromen-4-one |
| SMILES | COc1ccc2occ(CCCCN3CCN(c4cccc(C(F)(F)F)c4)CC3)c(=O)c2c1 |
| InChI | InChI=1S/C25H27F3N2O3/c1-32-21-8-9-23-22(16-21)24(31)18(17-33-23)5-2-3-10-29-11-13-30(14-12-29)20-7-4-6-19(15-20)25(26,27)28/h4,6-9,15-17H,2-3,5,10-14H2,1H3 |
| InChIKey | DFCOBJYFUZVHPH-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 45.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.50 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|