C22H29F3IN5O — CID 111058922
1-(3-methoxyphenyl)-2-[3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]propyl]guanidine;hydroiodide (PubChem CID 111058922) has the molecular formula C22H29F3IN5O and a molecular weight of 563.41 g/mol. Its IUPAC name is 1-(3-methoxyphenyl)-2-[3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]propyl]guanidine;hydroiodide.
| Compound Name | 1-(3-methoxyphenyl)-2-[3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111058922 |
| Molecular Formula | C22H29F3IN5O |
| Molecular Weight | 563.41 g/mol |
| Exact Mass | 563.14 |
| IUPAC Name | 1-(3-methoxyphenyl)-2-[3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]propyl]guanidine;hydroiodide |
| SMILES | COc1cccc(N/C(N)=N/CCCN2CCN(c3cccc(C(F)(F)F)c3)CC2)c1.I |
| InChI | InChI=1S/C22H28F3N5O.HI/c1-31-20-8-3-6-18(16-20)28-21(26)27-9-4-10-29-11-13-30(14-12-29)19-7-2-5-17(15-19)22(23,24)25;/h2-3,5-8,15-16H,4,9-14H2,1H3,(H3,26,27,28);1H |
| InChIKey | CRUCGUNITZDMEH-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 66.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.41 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|