C21H23ClFNO2 — CID 23503572
[1-[2-(4-chlorophenyl)-2-methoxyethyl]piperidin-4-yl]-(4-fluorophenyl)methanone (PubChem CID 23503572) has the molecular formula C21H23ClFNO2 and a molecular weight of 375.87 g/mol. Its IUPAC name is [1-[2-(4-chlorophenyl)-2-methoxyethyl]piperidin-4-yl]-(4-fluorophenyl)methanone.
| Compound Name | [1-[2-(4-chlorophenyl)-2-methoxyethyl]piperidin-4-yl]-(4-fluorophenyl)methanone |
|---|---|
| PubChem CID | 23503572 |
| Molecular Formula | C21H23ClFNO2 |
| Molecular Weight | 375.87 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | [1-[2-(4-chlorophenyl)-2-methoxyethyl]piperidin-4-yl]-(4-fluorophenyl)methanone |
| SMILES | COC(CN1CCC(C(=O)c2ccc(F)cc2)CC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H23ClFNO2/c1-26-20(15-2-6-18(22)7-3-15)14-24-12-10-17(11-13-24)21(25)16-4-8-19(23)9-5-16/h2-9,17,20H,10-14H2,1H3 |
| InChIKey | WTPBVCWNYNADPZ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.87 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |