C22H28Cl2N2O2 — CID 167921657
1,4-bis[2-(4-chlorophenyl)-2-methoxyethyl]piperazine (PubChem CID 167921657) has the molecular formula C22H28Cl2N2O2 and a molecular weight of 423.38 g/mol. Its IUPAC name is 1,4-bis[2-(4-chlorophenyl)-2-methoxyethyl]piperazine.
| Compound Name | 1,4-bis[2-(4-chlorophenyl)-2-methoxyethyl]piperazine |
|---|---|
| PubChem CID | 167921657 |
| Molecular Formula | C22H28Cl2N2O2 |
| Molecular Weight | 423.38 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | 1,4-bis[2-(4-chlorophenyl)-2-methoxyethyl]piperazine |
| SMILES | COC(CN1CCN(CC(OC)c2ccc(Cl)cc2)CC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H28Cl2N2O2/c1-27-21(17-3-7-19(23)8-4-17)15-25-11-13-26(14-12-25)16-22(28-2)18-5-9-20(24)10-6-18/h3-10,21-22H,11-16H2,1-2H3 |
| InChIKey | JMNNDOZUHFVKPW-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.38 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |