C14H19F2NOS — CID 104754679
1-cyclohexyl-2-(2,5-difluorophenyl)sulfinylethanamine (PubChem CID 104754679) has the molecular formula C14H19F2NOS and a molecular weight of 287.37 g/mol. Its IUPAC name is 1-cyclohexyl-2-(2,5-difluorophenyl)sulfinylethanamine.
| Compound Name | 1-cyclohexyl-2-(2,5-difluorophenyl)sulfinylethanamine |
|---|---|
| PubChem CID | 104754679 |
| Molecular Formula | C14H19F2NOS |
| Molecular Weight | 287.37 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | 1-cyclohexyl-2-(2,5-difluorophenyl)sulfinylethanamine |
| SMILES | NC(CS(=O)c1cc(F)ccc1F)C1CCCCC1 |
| InChI | InChI=1S/C14H19F2NOS/c15-11-6-7-12(16)14(8-11)19(18)9-13(17)10-4-2-1-3-5-10/h6-8,10,13H,1-5,9,17H2 |
| InChIKey | SHOFXCFAGBKKHQ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.37 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |