C8H6F2O2S — CID 66223483
2-(2,5-difluorophenyl)sulfinylacetaldehyde (PubChem CID 66223483) has the molecular formula C8H6F2O2S and a molecular weight of 204.20 g/mol. Its IUPAC name is 2-(2,5-difluorophenyl)sulfinylacetaldehyde.
| Compound Name | 2-(2,5-difluorophenyl)sulfinylacetaldehyde |
|---|---|
| PubChem CID | 66223483 |
| Molecular Formula | C8H6F2O2S |
| Molecular Weight | 204.20 g/mol |
| Exact Mass | 204.01 |
| IUPAC Name | 2-(2,5-difluorophenyl)sulfinylacetaldehyde |
| SMILES | O=CCS(=O)c1cc(F)ccc1F |
| InChI | InChI=1S/C8H6F2O2S/c9-6-1-2-7(10)8(5-6)13(12)4-3-11/h1-3,5H,4H2 |
| InChIKey | WSRKUNIMIQODGV-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.20 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|