C14H8Cl2F2O2S — CID 64641141
1-(2,5-dichlorophenyl)-2-(2,5-difluorophenyl)sulfinylethanone (PubChem CID 64641141) has the molecular formula C14H8Cl2F2O2S and a molecular weight of 349.19 g/mol. Its IUPAC name is 1-(2,5-dichlorophenyl)-2-(2,5-difluorophenyl)sulfinylethanone.
| Compound Name | 1-(2,5-dichlorophenyl)-2-(2,5-difluorophenyl)sulfinylethanone |
|---|---|
| PubChem CID | 64641141 |
| Molecular Formula | C14H8Cl2F2O2S |
| Molecular Weight | 349.19 g/mol |
| Exact Mass | 347.96 |
| IUPAC Name | 1-(2,5-dichlorophenyl)-2-(2,5-difluorophenyl)sulfinylethanone |
| SMILES | O=C(CS(=O)c1cc(F)ccc1F)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C14H8Cl2F2O2S/c15-8-1-3-11(16)10(5-8)13(19)7-21(20)14-6-9(17)2-4-12(14)18/h1-6H,7H2 |
| InChIKey | QVTGMTKVQYRHGI-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.19 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |