C14H9BrCl2O2S — CID 64641310
2-(4-bromophenyl)sulfinyl-1-(2,5-dichlorophenyl)ethanone (PubChem CID 64641310) has the molecular formula C14H9BrCl2O2S and a molecular weight of 392.10 g/mol. Its IUPAC name is 2-(4-bromophenyl)sulfinyl-1-(2,5-dichlorophenyl)ethanone.
| Compound Name | 2-(4-bromophenyl)sulfinyl-1-(2,5-dichlorophenyl)ethanone |
|---|---|
| PubChem CID | 64641310 |
| Molecular Formula | C14H9BrCl2O2S |
| Molecular Weight | 392.10 g/mol |
| Exact Mass | 389.89 |
| IUPAC Name | 2-(4-bromophenyl)sulfinyl-1-(2,5-dichlorophenyl)ethanone |
| SMILES | O=C(CS(=O)c1ccc(Br)cc1)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C14H9BrCl2O2S/c15-9-1-4-11(5-2-9)20(19)8-14(18)12-7-10(16)3-6-13(12)17/h1-7H,8H2 |
| InChIKey | AVEUFLGUUPUBBA-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.10 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |