5-(2,5-difluorophenyl)sulfinylpentanoic acid

C11H12F2O3S — CID 61303969

IUPAC5-(2,5-difluorophenyl)sulfinylpentanoic acid
SMILESO=C(O)CCCCS(=O)c1cc(F)ccc1F
InChIInChI=1S/C11H12F2O3S/c12-8-4-5-9(13)10(7-8)17(16)6-2-1-3-11(14)15/h4-5,7H,1-3,6H2,(H,14,15)
InChIKeyNFSVZKGYFKCGDV-UHFFFAOYSA-N
MW262.28 g/mol
LogP2.33
Rot. Bonds6

About 5-(2,5-difluorophenyl)sulfinylpentanoic acid

5-(2,5-difluorophenyl)sulfinylpentanoic acid (PubChem CID 61303969) has the molecular formula C11H12F2O3S and a molecular weight of 262.28 g/mol. Its IUPAC name is 5-(2,5-difluorophenyl)sulfinylpentanoic acid.

Molecular Properties

Compound Name5-(2,5-difluorophenyl)sulfinylpentanoic acid
PubChem CID61303969
Molecular FormulaC11H12F2O3S
Molecular Weight262.28 g/mol
Exact Mass262.05
IUPAC Name5-(2,5-difluorophenyl)sulfinylpentanoic acid
SMILESO=C(O)CCCCS(=O)c1cc(F)ccc1F
InChIInChI=1S/C11H12F2O3S/c12-8-4-5-9(13)10(7-8)17(16)6-2-1-3-11(14)15/h4-5,7H,1-3,6H2,(H,14,15)
InChIKeyNFSVZKGYFKCGDV-UHFFFAOYSA-N
XLogP2.33
TPSA54.37 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds6
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500262.28
LogP ≤ 52.33
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 5-(2,5-difluorophenyl)sulfinylpentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-(2,5-difluorophenyl)sulfinylpentanoic acid?
The IUPAC name of 5-(2,5-difluorophenyl)sulfinylpentanoic acid (CID 61303969) is 5-(2,5-difluorophenyl)sulfinylpentanoic acid.
What is the SMILES notation for 5-(2,5-difluorophenyl)sulfinylpentanoic acid?
The canonical SMILES for 5-(2,5-difluorophenyl)sulfinylpentanoic acid is O=C(O)CCCCS(=O)c1cc(F)ccc1F.
What is the InChIKey of 5-(2,5-difluorophenyl)sulfinylpentanoic acid?
The InChIKey is NFSVZKGYFKCGDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12F2O3S/c12-8-4-5-9(13)10(7-8)17(16)6-2-1-3-11(14)15/h4-5,7H,1-3,6H2,(H,14,15).
What are the key properties of 5-(2,5-difluorophenyl)sulfinylpentanoic acid?
5-(2,5-difluorophenyl)sulfinylpentanoic acid has a molecular weight of 262.28 g/mol, XLogP of 2.33, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,5-difluorophenyl)sulfinylpentanoic acid is sourced from PubChem (CID 61303969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).