C12H14F2O2S — CID 106808610
6-(2,4-difluorophenyl)sulfinylhexan-3-one (PubChem CID 106808610) has the molecular formula C12H14F2O2S and a molecular weight of 260.30 g/mol. Its IUPAC name is 6-(2,4-difluorophenyl)sulfinylhexan-3-one.
| Compound Name | 6-(2,4-difluorophenyl)sulfinylhexan-3-one |
|---|---|
| PubChem CID | 106808610 |
| Molecular Formula | C12H14F2O2S |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | 6-(2,4-difluorophenyl)sulfinylhexan-3-one |
| SMILES | CCC(=O)CCCS(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C12H14F2O2S/c1-2-10(15)4-3-7-17(16)12-6-5-9(13)8-11(12)14/h5-6,8H,2-4,7H2,1H3 |
| InChIKey | WQQHXZAQVQMZSP-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |