C13H15F2NOS — CID 65262989
5-(2,4-difluorophenyl)sulfinyl-2,2-dimethylpentanenitrile (PubChem CID 65262989) has the molecular formula C13H15F2NOS and a molecular weight of 271.33 g/mol. Its IUPAC name is 5-(2,4-difluorophenyl)sulfinyl-2,2-dimethylpentanenitrile.
| Compound Name | 5-(2,4-difluorophenyl)sulfinyl-2,2-dimethylpentanenitrile |
|---|---|
| PubChem CID | 65262989 |
| Molecular Formula | C13H15F2NOS |
| Molecular Weight | 271.33 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | 5-(2,4-difluorophenyl)sulfinyl-2,2-dimethylpentanenitrile |
| SMILES | CC(C)(C#N)CCCS(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C13H15F2NOS/c1-13(2,9-16)6-3-7-18(17)12-5-4-10(14)8-11(12)15/h4-5,8H,3,6-7H2,1-2H3 |
| InChIKey | GQUSLNPMWCPWOC-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.33 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |