C15H18BrNO3S — CID 106713654
4-bromo-2-(5-cyano-5-methylhexyl)sulfinylbenzoic acid (PubChem CID 106713654) has the molecular formula C15H18BrNO3S and a molecular weight of 372.28 g/mol. Its IUPAC name is 4-bromo-2-(5-cyano-5-methylhexyl)sulfinylbenzoic acid.
| Compound Name | 4-bromo-2-(5-cyano-5-methylhexyl)sulfinylbenzoic acid |
|---|---|
| PubChem CID | 106713654 |
| Molecular Formula | C15H18BrNO3S |
| Molecular Weight | 372.28 g/mol |
| Exact Mass | 371.02 |
| IUPAC Name | 4-bromo-2-(5-cyano-5-methylhexyl)sulfinylbenzoic acid |
| SMILES | CC(C)(C#N)CCCCS(=O)c1cc(Br)ccc1C(=O)O |
| InChI | InChI=1S/C15H18BrNO3S/c1-15(2,10-17)7-3-4-8-21(20)13-9-11(16)5-6-12(13)14(18)19/h5-6,9H,3-4,7-8H2,1-2H3,(H,18,19) |
| InChIKey | PUQCPDACELBOFR-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 78.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.28 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|