C10H11BrO5S2 — CID 115382548
4-bromo-2-(2-methylsulfonylethylsulfinyl)benzoic acid (PubChem CID 115382548) has the molecular formula C10H11BrO5S2 and a molecular weight of 355.23 g/mol. Its IUPAC name is 4-bromo-2-(2-methylsulfonylethylsulfinyl)benzoic acid.
| Compound Name | 4-bromo-2-(2-methylsulfonylethylsulfinyl)benzoic acid |
|---|---|
| PubChem CID | 115382548 |
| Molecular Formula | C10H11BrO5S2 |
| Molecular Weight | 355.23 g/mol |
| Exact Mass | 353.92 |
| IUPAC Name | 4-bromo-2-(2-methylsulfonylethylsulfinyl)benzoic acid |
| SMILES | CS(=O)(=O)CCS(=O)c1cc(Br)ccc1C(=O)O |
| InChI | InChI=1S/C10H11BrO5S2/c1-18(15,16)5-4-17(14)9-6-7(11)2-3-8(9)10(12)13/h2-3,6H,4-5H2,1H3,(H,12,13) |
| InChIKey | VJEBRKIXQPHNPJ-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.23 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |