4-bromo-2-[(3,5-dimethylphenyl)methylsulfinyl]benzoic acid

C16H15BrO3S — CID 115382442

IUPAC4-bromo-2-[(3,5-dimethylphenyl)methylsulfinyl]benzoic acid
SMILESCc1cc(C)cc(CS(=O)c2cc(Br)ccc2C(=O)O)c1
InChIInChI=1S/C16H15BrO3S/c1-10-5-11(2)7-12(6-10)9-21(20)15-8-13(17)3-4-14(15)16(18)19/h3-8H,9H2,1-2H3,(H,18,19)
InChIKeyVSOUIWZXUOIKAG-UHFFFAOYSA-N
MW367.26 g/mol
LogP4.07
Rot. Bonds4

About 4-bromo-2-[(3,5-dimethylphenyl)methylsulfinyl]benzoic acid

4-bromo-2-[(3,5-dimethylphenyl)methylsulfinyl]benzoic acid (PubChem CID 115382442) has the molecular formula C16H15BrO3S and a molecular weight of 367.26 g/mol. Its IUPAC name is 4-bromo-2-[(3,5-dimethylphenyl)methylsulfinyl]benzoic acid.

Molecular Properties

Compound Name4-bromo-2-[(3,5-dimethylphenyl)methylsulfinyl]benzoic acid
PubChem CID115382442
Molecular FormulaC16H15BrO3S
Molecular Weight367.26 g/mol
Exact Mass365.99
IUPAC Name4-bromo-2-[(3,5-dimethylphenyl)methylsulfinyl]benzoic acid
SMILESCc1cc(C)cc(CS(=O)c2cc(Br)ccc2C(=O)O)c1
InChIInChI=1S/C16H15BrO3S/c1-10-5-11(2)7-12(6-10)9-21(20)15-8-13(17)3-4-14(15)16(18)19/h3-8H,9H2,1-2H3,(H,18,19)
InChIKeyVSOUIWZXUOIKAG-UHFFFAOYSA-N
XLogP4.07
TPSA54.37 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms21
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500367.26
LogP ≤ 54.07
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 4-bromo-2-[(3,5-dimethylphenyl)methylsulfinyl]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-bromo-2-[(3,5-dimethylphenyl)methylsulfinyl]benzoic acid?
The IUPAC name of 4-bromo-2-[(3,5-dimethylphenyl)methylsulfinyl]benzoic acid (CID 115382442) is 4-bromo-2-[(3,5-dimethylphenyl)methylsulfinyl]benzoic acid.
What is the SMILES notation for 4-bromo-2-[(3,5-dimethylphenyl)methylsulfinyl]benzoic acid?
The canonical SMILES for 4-bromo-2-[(3,5-dimethylphenyl)methylsulfinyl]benzoic acid is Cc1cc(C)cc(CS(=O)c2cc(Br)ccc2C(=O)O)c1.
What is the InChIKey of 4-bromo-2-[(3,5-dimethylphenyl)methylsulfinyl]benzoic acid?
The InChIKey is VSOUIWZXUOIKAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15BrO3S/c1-10-5-11(2)7-12(6-10)9-21(20)15-8-13(17)3-4-14(15)16(18)19/h3-8H,9H2,1-2H3,(H,18,19).
What are the key properties of 4-bromo-2-[(3,5-dimethylphenyl)methylsulfinyl]benzoic acid?
4-bromo-2-[(3,5-dimethylphenyl)methylsulfinyl]benzoic acid has a molecular weight of 367.26 g/mol, XLogP of 4.07, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-2-[(3,5-dimethylphenyl)methylsulfinyl]benzoic acid is sourced from PubChem (CID 115382442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).