C16H15BrO3S — CID 115382442
4-bromo-2-[(3,5-dimethylphenyl)methylsulfinyl]benzoic acid (PubChem CID 115382442) has the molecular formula C16H15BrO3S and a molecular weight of 367.26 g/mol. Its IUPAC name is 4-bromo-2-[(3,5-dimethylphenyl)methylsulfinyl]benzoic acid.
| Compound Name | 4-bromo-2-[(3,5-dimethylphenyl)methylsulfinyl]benzoic acid |
|---|---|
| PubChem CID | 115382442 |
| Molecular Formula | C16H15BrO3S |
| Molecular Weight | 367.26 g/mol |
| Exact Mass | 365.99 |
| IUPAC Name | 4-bromo-2-[(3,5-dimethylphenyl)methylsulfinyl]benzoic acid |
| SMILES | Cc1cc(C)cc(CS(=O)c2cc(Br)ccc2C(=O)O)c1 |
| InChI | InChI=1S/C16H15BrO3S/c1-10-5-11(2)7-12(6-10)9-21(20)15-8-13(17)3-4-14(15)16(18)19/h3-8H,9H2,1-2H3,(H,18,19) |
| InChIKey | VSOUIWZXUOIKAG-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.26 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |