C14H19BrN2OS — CID 106714904
6-(4-amino-2-bromophenyl)sulfinyl-2,2-dimethylhexanenitrile (PubChem CID 106714904) has the molecular formula C14H19BrN2OS and a molecular weight of 343.29 g/mol. Its IUPAC name is 6-(4-amino-2-bromophenyl)sulfinyl-2,2-dimethylhexanenitrile.
| Compound Name | 6-(4-amino-2-bromophenyl)sulfinyl-2,2-dimethylhexanenitrile |
|---|---|
| PubChem CID | 106714904 |
| Molecular Formula | C14H19BrN2OS |
| Molecular Weight | 343.29 g/mol |
| Exact Mass | 342.04 |
| IUPAC Name | 6-(4-amino-2-bromophenyl)sulfinyl-2,2-dimethylhexanenitrile |
| SMILES | CC(C)(C#N)CCCCS(=O)c1ccc(N)cc1Br |
| InChI | InChI=1S/C14H19BrN2OS/c1-14(2,10-16)7-3-4-8-19(18)13-6-5-11(17)9-12(13)15/h5-6,9H,3-4,7-8,17H2,1-2H3 |
| InChIKey | QNEPRCAGDNMFAC-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 66.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.29 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|